| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:21 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231786 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H38O8 |
|---|
| Molecular Mass | 454.2567 |
|---|
| SMILES | CC12CCC3CC(O3)OC(C(=O)O)C(O)C(O)C(O)C1CCC1C3CC(O)CC3CCC12 |
|---|
| InChI Key | RBIYKNAGJNPHGY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxetanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcyclic alcoholcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacetaloxetanesecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|