| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:21 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O5S |
|---|
| Molecular Mass | 192.0092 |
|---|
| SMILES | CC1=C(C(=O)O)C(C)S(=O)(=O)O1 |
|---|
| InChI Key | UQYGTSWGLJOGTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | sulfonic acid esters |
|---|
| Direct Parent | sulfonic acid esters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acid estersoxacyclic compoundsoxathioles |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidcarboxylic acid derivativeorganosulfonic acid estersulfonic acid esteroxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound1,2-oxathiolealiphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|