| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:21 UTC |
|---|
| Update Date | 2025-03-25 00:58:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231820 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H52O14 |
|---|
| Molecular Mass | 660.3357 |
|---|
| SMILES | CC12CCC(OC3OC(CO)C(OC4OC(CO)C(O)C(O)C4O)C(O)C3O)CC1CCC1C2CCC2(C)C1CCC2(O)C(=O)O |
|---|
| InChI Key | VDEXITSIZYRLFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroidal glycosides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 17-hydroxysteroidsacetalsalpha hydroxy acids and derivativesandrostane steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstertiary alcohols |
|---|
| Substituents | 20-hydroxysteroidcarbonyl groupcarboxylic acidsteroidal glycosidealpha-hydroxy acidmonosaccharidecarboxylic acid derivativealiphatic heteropolycyclic compoundsaccharideorganic oxideacetaloxaneprimary alcoholorganoheterocyclic compound17-hydroxysteroidalcoholhydroxysteroidhydroxy acidcyclic alcoholoxacycletertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
