| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:22 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231825 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O6P |
|---|
| Molecular Mass | 208.0137 |
|---|
| SMILES | CC1(C)OC(=O)C2OP(=O)(O)OC21 |
|---|
| InChI Key | GCWMOXKJIASHIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | lactones |
|---|
| Subclass | gamma butyrolactones |
|---|
| Direct Parent | gamma butyrolactones |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdioxaphospholaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | carbonyl grouptetrahydrofuran1,3_dioxaphospholanecarboxylic acid derivativegamma butyrolactonealiphatic heteropolycyclic compoundoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganic phosphoric acid derivativeorganooxygen compound |
|---|
