| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:25 UTC |
|---|
| Update Date | 2025-03-25 00:58:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231952 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O2 |
|---|
| Molecular Mass | 202.0994 |
|---|
| SMILES | CC1=CC(=O)CC(Cc2ccccc2)O1 |
|---|
| InChI Key | FHFHRBIKQGIZGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescyclic ketoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsvinylogous esters |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compounddihydropyranonevinylogous estercyclic ketoneketoneoxacycleorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
