| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:26 UTC |
|---|
| Update Date | 2025-03-25 00:58:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231983 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22O |
|---|
| Molecular Mass | 206.1671 |
|---|
| SMILES | CC1=CCC2C(C(C)=CC1)C(O)C2(C)C |
|---|
| InChI Key | QYGGJGHXHAEYBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclic alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativessecondary alcohols |
|---|
| Substituents | cyclobutanolsecondary alcoholhydrocarbon derivativealiphatic homopolycyclic compound |
|---|