| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:28 UTC |
|---|
| Update Date | 2025-03-25 00:58:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02232053 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C41H44N4O10 |
|---|
| Molecular Mass | 752.3057 |
|---|
| SMILES | CC1=C(CC(=O)O)N=C2C=c3[nH]c(c(C)c3CCC(=O)O)=CC3=NC(=Cc4[nH]c(c(CCC(=O)O)c4C)C=C1C(C)=C2CCC(=O)O)C(CCC(=O)O)=C3C |
|---|
| InChI Key | LICMBBXIWIXUAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsazepinescarbonyl compoundscarboxylic acidsdipyrrinsheteroaromatic compoundshydrocarbon derivativesketiminesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrroles |
|---|
| Substituents | ketiminecarbonyl groupcarboxylic acidazacycleimineheteroaromatic compoundorganic 1,3-dipolar compoundpentacarboxylic acid or derivativespropargyl-type 1,3-dipolar organic compounddipyrrinorganic oxideorganic oxygen compoundazepinearomatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
