| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:28 UTC |
|---|
| Update Date | 2025-03-25 00:58:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02232081 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15NO5 |
|---|
| Molecular Mass | 301.095 |
|---|
| SMILES | CC1=CC(=CC=NC(Cc2ccc(O)cc2)C(=O)O)OC1=O |
|---|
| InChI Key | WMSIFTHWFGGBGA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaldiminesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativesbutenolidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesdihydrofuransenoate estersenol estershydrocarbon derivativeslactonesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalanine and derivativesphenylpropanoic acidspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidimine1-hydroxy-2-unsubstituted benzenoidpropargyl-type 1,3-dipolar organic compoundlactonealdiminealpha,beta-unsaturated carboxylic ester2-furanoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundenol esterorganoheterocyclic compoundamphetamine or derivativesdihydrofuranenoate estertyrosine or derivativesorganic 1,3-dipolar compoundoxacyclephenylalanine or derivativesorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|