| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:47 UTC |
|---|
| Update Date | 2025-03-25 00:58:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02232790 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16O7 |
|---|
| Molecular Mass | 236.0896 |
|---|
| SMILES | CCC(=O)OC(C=O)C(O)C(O)C(O)CO |
|---|
| InChI Key | BXNIPUPZEZMZJG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-acyloxy aldehydesbeta-hydroxy aldehydescarboxylic acid estershydrocarbon derivativesmedium-chain aldehydesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupmonosaccharidealdehydecarboxylic acid derivativemedium-chain aldehydesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary alcoholalpha-acyloxy aldehydeorganooxygen compound |
|---|