| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:56 UTC |
|---|
| Update Date | 2025-03-25 00:58:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233125 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10F2O4S |
|---|
| Molecular Mass | 216.0268 |
|---|
| SMILES | CCC(C)C(=O)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | QJFBICMYRGVPJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-haloketoneshydrocarbon derivativesorganic oxidesorganofluoridessulfonyls |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupalkyl fluorideorganofluorideorganosulfonic acidorganosulfur compoundorganohalogen compoundketoneorganic oxidesulfonylorganic oxygen compoundalpha-haloketonealkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
