| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:03 UTC |
|---|
| Update Date | 2025-03-25 00:58:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233382 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28O3S |
|---|
| Molecular Mass | 324.1759 |
|---|
| SMILES | CCCCCC=CCC=CC=CC=CC(=O)SCC(O)CO |
|---|
| InChI Key | FREYQKYRTCCYLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl thioesters |
|---|
| Direct Parent | fatty acyl thioesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarbothioic s-esterscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesprimary alcoholssecondary alcoholssulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupthiocarboxylic acid or derivativessulfenyl compoundthiocarboxylic acid esterorganosulfur compoundcarboxylic acid derivativecarbothioic s-esterorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary alcoholfatty acyl thioesterthiolactoneorganooxygen compound1,2-diol |
|---|