| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:05 UTC |
|---|
| Update Date | 2025-03-25 00:58:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233450 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO3 |
|---|
| Molecular Mass | 233.1052 |
|---|
| SMILES | COc1cc2c(CCN)ccc(O)c2cc1O |
|---|
| InChI Key | ZVFDTNWYNKWXNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesmonoalkylaminesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | phenol etherether1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl etherorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-naphtholprimary aliphatic amineorganic nitrogen compound2-naphtholorganooxygen compound |
|---|
