| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:06 UTC |
|---|
| Update Date | 2025-03-25 00:58:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233514 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28O8 |
|---|
| Molecular Mass | 444.1784 |
|---|
| SMILES | COc1ccc(C2OCC3C(c4cc(OC)c(OC)c(OC)c4)C(C(=O)O)C23)cc1OC |
|---|
| InChI Key | ABKOYARMGGODOO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxepanesphenoxy compoundstetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidalkyl aryl ethercarboxylic acid derivativedialkyl etherdimethoxybenzeneorganic oxidearomatic heteropolycyclic compoundo-dimethoxybenzeneorganoheterocyclic compoundtetrahydrofuranoxepaneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolehydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|