| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:09 UTC |
|---|
| Update Date | 2025-03-25 00:58:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233639 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17ClN6O2 |
|---|
| Molecular Mass | 348.1102 |
|---|
| SMILES | CC(=O)N1c2c(nc(N)[nH]c2=O)NCC1CNc1ccc(Cl)cc1 |
|---|
| InChI Key | VZIGOLVBVYNFPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganochloridesorganopnictogen compoundsphenylalkylaminesprimary aminespyrimidonessecondary alkylarylaminestertiary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamamino acid or derivativesorganochloridepyrimidonecarboxylic acid derivativeorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundimidolactamacetamidearyl chloridechlorobenzenevinylogous amidepterinazacycleheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic aminearyl halideorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
