| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:09 UTC |
|---|
| Update Date | 2025-03-25 00:58:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233644 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N3O6 |
|---|
| Molecular Mass | 271.0804 |
|---|
| SMILES | O=CNc1nc(=O)[nH]cc1C1OC(CO)C(O)C1O |
|---|
| InChI Key | OALPNDSMSISFQP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupetheraromatic heteromonocyclic compoundmonosaccharidepyrimidonen-arylamidecarboxylic acid derivativedialkyl etherpyrimidinesaccharideorganic oxideorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
