| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:13 UTC |
|---|
| Update Date | 2025-03-25 00:58:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233794 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O8P |
|---|
| Molecular Mass | 240.0035 |
|---|
| SMILES | O=C1OC(COP(=O)(O)O)=CC(O)C1O |
|---|
| InChI Key | IMUFRDNJXMSCHC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundsenol estershydrocarbon derivativeslactonesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupdihydropyranonecarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeenol esterorganic phosphoric acid derivativealkyl phosphateorganooxygen compound1,2-diol |
|---|