| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:14 UTC |
|---|
| Update Date | 2025-03-25 00:58:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233822 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O2 |
|---|
| Molecular Mass | 256.1212 |
|---|
| SMILES | NC(=O)c1cc(-c2ccccc2)ccc1NCCO |
|---|
| InChI Key | PVCKTFKNMKHQFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminesamino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary carboxylic acid amidessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amideamino acid or derivativesbenzoylcarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundalkanolaminealcoholvinylogous amidesecondary aminecarboxamide groupsecondary aliphatic/aromatic aminearomatic homomonocyclic compoundorganic oxygen compoundphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
