| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:15 UTC |
|---|
| Update Date | 2025-03-25 00:58:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233852 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N2O6 |
|---|
| Molecular Mass | 346.1165 |
|---|
| SMILES | O=c1[nH]c2ccc3ccccc3c2n1C1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | HCKNDJJURMHMAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | 1-pyranosylbenzimidazoles |
|---|
| Direct Parent | 1-pyranosylbenzimidazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzimidazolesheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesnaphthalenesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | monosaccharidesaccharideorganic oxidearomatic heteropolycyclic compoundbenzimidazoleimidazoleorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacyclenaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound1-pyranosylbenzimidazoleorganooxygen compound |
|---|
