| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:16 UTC |
|---|
| Update Date | 2025-03-25 00:58:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233909 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10Cl2O3 |
|---|
| Molecular Mass | 248.0007 |
|---|
| SMILES | O=C(O)C(CO)Cc1cc(Cl)cc(Cl)c1 |
|---|
| InChI Key | CMPJVZKLPBXSPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesprimary alcohols |
|---|
| Substituents | aryl chloridechlorobenzenealcoholmonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidorganochloridehydroxy acidcarboxylic acid derivativeorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneprimary alcoholorganooxygen compound |
|---|