| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:16 UTC |
|---|
| Update Date | 2025-03-25 00:58:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233917 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20O11 |
|---|
| Molecular Mass | 340.1006 |
|---|
| SMILES | O=C(O)C1OOC(OC2CC(CO)C(O)C(O)C2O)C(O)C1O |
|---|
| InChI Key | WSOIRULZRCWCKM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-dioxanesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativesdialkyl peroxideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsprimary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativeoxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesdialkyl peroxidealiphatic heteromonocyclic compoundhydrocarbon derivativeprimary alcoholortho-dioxaneorganoheterocyclic compound |
|---|