| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:18 UTC |
|---|
| Update Date | 2025-03-25 00:58:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02233984 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21N3O |
|---|
| Molecular Mass | 283.1685 |
|---|
| SMILES | CN(C)CCNC(=O)c1ccccc1Nc1ccccc1 |
|---|
| InChI Key | FCTOJJNWKOBUCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary aminessecondary carboxylic acid amidestrialkylaminesvinylogous amides |
|---|
| Substituents | vinylogous amideamino acid or derivativestertiary aliphatic aminebenzoylsecondary aminecarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
