| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:21 UTC |
|---|
| Update Date | 2025-03-25 00:58:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234084 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO4S2 |
|---|
| Molecular Mass | 261.013 |
|---|
| SMILES | O=C(O)CC(N=CC=C1SCCS1)C(=O)O |
|---|
| InChI Key | WUYRFUSCTNQURT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dithiolanesaldiminesalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acylsheterocyclic fatty acidshydrocarbon derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidheterocyclic fatty acidiminepropargyl-type 1,3-dipolar organic compoundaldimineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compound1,3-dithiolaneorganoheterocyclic compoundorganic 1,3-dipolar compoundorganic oxygen compounddithiolaneaspartic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|