| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:22 UTC |
|---|
| Update Date | 2025-03-25 00:58:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234146 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O8 |
|---|
| Molecular Mass | 234.0376 |
|---|
| SMILES | O=C(O)CC1COC(CC(=O)O)(C(=O)O)O1 |
|---|
| InChI Key | SGHJXUIRFAJFKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanescarbonyl compoundscarboxylic acidshydrocarbon derivativesketalsorganic oxidesoxacyclic compounds |
|---|
| Substituents | meta-dioxolanecarbonyl groupcarboxylic acidtricarboxylic acid or derivativesoxacycleorganic oxideorganic oxygen compoundacetalketalaliphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
