| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:24 UTC |
|---|
| Update Date | 2025-03-25 00:58:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234198 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10O4 |
|---|
| Molecular Mass | 218.0579 |
|---|
| SMILES | Cc1c(O)cc2c(O)cc(O)cc2c1C=O |
|---|
| InChI Key | ZKUHNVJWANHSSB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl-aldehydeshydrocarbon derivativesnaphthols and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | 1-hydroxy-2-unsubstituted benzenoidaldehydearomatic homopolycyclic compound1-naphthalenecarboxylic acid1-hydroxy-4-unsubstituted benzenoidorganic oxidearyl-aldehydeorganic oxygen compoundhydrocarbon derivative1-naphthol2-naphtholorganooxygen compound |
|---|
