| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:25 UTC |
|---|
| Update Date | 2025-03-25 00:58:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234257 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4N4O7S |
|---|
| Molecular Mass | 275.9801 |
|---|
| SMILES | O=c1[nH]c2nc(O)nc(O)c2nc1OS(=O)(=O)O |
|---|
| InChI Key | JRBGNSBKPGSZKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | arylsulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidineslactamsorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterlactamorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyrimidinepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfateorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|