| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:26 UTC |
|---|
| Update Date | 2025-03-25 00:59:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234275 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O2 |
|---|
| Molecular Mass | 254.1307 |
|---|
| SMILES | Cc1cc(O)c(C)c2c1CCC(c1ccccc1)O2 |
|---|
| InChI Key | VNLPCBOABDKNNA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 7-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoidchromanehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|