| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:27 UTC |
|---|
| Update Date | 2025-03-25 00:59:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234340 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7F3O3 |
|---|
| Molecular Mass | 220.0347 |
|---|
| SMILES | Cc1cc(C(F)(F)F)cc(C(=O)O)c1O |
|---|
| InChI Key | CDHMIVOXKPZRBK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalkyl fluoridesbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compoundsortho cresolsphenolstoluenestrifluoromethylbenzenesvinylogous acids |
|---|
| Substituents | carboxylic acidbenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxideo-cresolalkyl halide1-carboxy-2-haloaromatic compoundbenzoic acidtrifluoromethylbenzenealkyl fluorideorganofluoridearomatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativetolueneorganooxygen compound |
|---|
