| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:28 UTC |
|---|
| Update Date | 2025-03-25 00:59:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234371 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O3 |
|---|
| Molecular Mass | 262.1317 |
|---|
| SMILES | COC(=O)c1ccccc1C(=O)N1CCN(C)CC1 |
|---|
| InChI Key | IZVJULBHPHUNEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzamidesbenzoyl derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesn-methylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aromatic heteromonocyclic compoundamino acid or derivativesbenzoylbenzoate estercarboxylic acid derivativebenzamideorganic oxidemethyl esterpiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundazacyclen-alkylpiperazinetertiary aliphatic aminen-methylpiperazinecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compound1,4-diazinanecarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
