| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:30 UTC |
|---|
| Update Date | 2025-03-25 00:59:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234442 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O5 |
|---|
| Molecular Mass | 244.0372 |
|---|
| SMILES | O=c1ccc2cc(O)c3ccc(O)c(O)c3c2o1 |
|---|
| InChI Key | SGSYPNOSAHJUDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcoumarinlactoneoxacyclenaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivative1-naphtholbenzenoid2-naphtholorganooxygen compound |
|---|
