| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:30 UTC |
|---|
| Update Date | 2025-03-25 00:59:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234446 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7O6P |
|---|
| Molecular Mass | 241.998 |
|---|
| SMILES | O=c1ccc2cc(OP(=O)(O)O)ccc2o1 |
|---|
| InChI Key | VENSWSIVZIIWRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransaryl phosphomonoestersbenzenoidsheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyran1-benzopyranheteroaromatic compoundcoumarinlactoneoxacycleorganic oxideorganic oxygen compoundphosphoric acid esteraromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativearyl phosphomonoesterbenzenoidaryl phosphateorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
