| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:31 UTC |
|---|
| Update Date | 2025-03-25 00:59:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234492 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H16NO5+ |
|---|
| Molecular Mass | 206.1023 |
|---|
| SMILES | C[N+](C)(C)C1OC(O)(C(=O)O)CC1O |
|---|
| InChI Key | IIOQRWJHYCQZHN-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | alpha hydroxy acids and derivatives |
|---|
| Direct Parent | alpha hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshemiacetalshemiaminalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetraalkylammonium saltstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativehemiaminalorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalorganic cationorganic saltorganoheterocyclic compoundalcoholtetraalkylammonium salttetrahydrofuranoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
