| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:33 UTC |
|---|
| Update Date | 2025-03-25 00:59:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234564 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9NOS |
|---|
| Molecular Mass | 227.0405 |
|---|
| SMILES | Oc1ccc2c(c1)[nH]c(=S)c1ccccc12 |
|---|
| InChI Key | SIHFBNHRKFYURG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | benzoquinolines |
|---|
| Direct Parent | phenanthridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesisoquinolines and derivativesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfur compoundspolyhalopyridinesthiolactams |
|---|
| Substituents | azacyclepolyhalopyridineheteroaromatic compoundhydroxypyridine1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundpyridineorganic oxygen compoundaromatic heteropolycyclic compoundthiolactamorganonitrogen compoundisoquinolineorganopnictogen compoundhydrocarbon derivativebenzenoidphenanthridine2-halopyridineorganic nitrogen compoundorganooxygen compound |
|---|
