| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:37 UTC |
|---|
| Update Date | 2025-03-25 00:59:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234723 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8N6 |
|---|
| Molecular Mass | 212.081 |
|---|
| SMILES | c1ccc(Nc2ncnc3nc[nH]c23)nc1 |
|---|
| InChI Key | JJUQIYGFWLKVJO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganopnictogen compoundspyridines and derivativespyrimidines and pyrimidine derivativessecondary amines |
|---|
| Substituents | azacycleheteroaromatic compoundsecondary aminepyrimidinepyridinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepurine2-halopyridineorganic nitrogen compoundimidolactamamineazole |
|---|
