| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:38 UTC |
|---|
| Update Date | 2025-03-25 00:59:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234777 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21NO6 |
|---|
| Molecular Mass | 311.1369 |
|---|
| SMILES | Cc1cccc(C)c1C(=O)NC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | IHFIIOZSEAYPCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzamidesbenzoyl derivativescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundbenzoylmonosaccharidecarboxylic acid derivativebenzamiden-acyl-alpha-hexosaminexyleneorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholm-xylenebenzoic acid or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|