| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:39 UTC |
|---|
| Update Date | 2025-03-25 00:59:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234800 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O5S |
|---|
| Molecular Mass | 292.0405 |
|---|
| SMILES | O=S(O)c1cc(O)cc2c1-c1c(O)cc(O)cc1CC2 |
|---|
| InChI Key | YYMQAXDUAPGEST-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesnaphthalenesorganic oxidesorganooxygen compoundsorganosulfur compoundssulfinic acids |
|---|
| Substituents | phenanthrenesulfinic acid derivative1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidorganosulfur compoundsulfinic acidorganic oxidenaphthaleneorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|