| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234867 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O |
|---|
| Molecular Mass | 242.1419 |
|---|
| SMILES | CNC(Cc1ccccc1)C(O)c1ccccn1 |
|---|
| InChI Key | CFWLCYFIIOKLHB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaromatic alcoholsazacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholsecondary aliphatic aminearomatic heteromonocyclic compoundazacycleheteroaromatic compoundhydroxypyridinemethylpyridinesecondary aminepyridineorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivative2-halopyridineorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundamphetamine or derivativesamine |
|---|
