| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234874 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N4 |
|---|
| Molecular Mass | 224.1062 |
|---|
| SMILES | c1cncc(C2=NNC(c3cccnc3)C2)c1 |
|---|
| InChI Key | XCGGLUFXIMTNGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridines and derivatives |
|---|
| Direct Parent | pyridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrazoneshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundspyrazolines |
|---|
| Substituents | pyridinearomatic heteromonocyclic compoundazacycleheteroaromatic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhydrazonepyrazoline |
|---|
