| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234877 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12N4O2S |
|---|
| Molecular Mass | 204.0681 |
|---|
| SMILES | Cc1nn(C)c(C)c1NS(N)(=O)=O |
|---|
| InChI Key | HYVTUMBJAMJMGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid diamides |
|---|
| Direct Parent | sulfuric acid diamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazoles |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrazolesulfuric acid diamideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundazole |
|---|