| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:42 UTC |
|---|
| Update Date | 2025-03-25 00:59:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234939 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17N3O2S2 |
|---|
| Molecular Mass | 287.0762 |
|---|
| SMILES | CNC(CCSCc1ccccc1)=NS(N)(=O)=O |
|---|
| InChI Key | JZOYJDGPTNUCAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amidinesdialkylthioethershydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundssulfenyl compounds |
|---|
| Substituents | monocyclic benzene moietyorganic sulfuric acid or derivativessulfenyl compounddialkylthioetheramidineorganosulfur compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
