| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:43 UTC |
|---|
| Update Date | 2025-03-25 00:59:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02234967 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N5+ |
|---|
| Molecular Mass | 218.14 |
|---|
| SMILES | Cc1nc(C)c(C[n+]2ccn(C)c2)c(N)n1 |
|---|
| InChI Key | IQRBJNJWKGWWJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic cationsorganopnictogen compoundsprimary amines |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidineimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamamineazolen-substituted imidazole |
|---|
