| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:46 UTC |
|---|
| Update Date | 2025-03-25 00:59:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235086 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16N4O8 |
|---|
| Molecular Mass | 404.0968 |
|---|
| SMILES | O=c1[nH]c(=O)n(C2OC(CO)C(O)C2O)c2nc(O)c(-c3ccc(O)cc3)nc12 |
|---|
| InChI Key | NFWIBRAZGXHORL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrazinespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactam1-hydroxy-2-unsubstituted benzenoidmonosaccharidepyrimidonepteridinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundpyrazinesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
