| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:47 UTC |
|---|
| Update Date | 2025-03-25 00:59:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235122 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N4O4 |
|---|
| Molecular Mass | 264.0859 |
|---|
| SMILES | O=c1[nH]c(=O)c2c(=O)cc(N3CCOCC3)[nH]c2[nH]1 |
|---|
| InChI Key | HJPIUZMVQBAOHY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridopyrimidines |
|---|
| Subclass | pyrido[2,3-d]pyrimidines |
|---|
| Direct Parent | pyrido[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaminopyridines and derivativesazacyclic compoundsdialkyl ethersdialkylarylaminesheteroaromatic compoundshydrocarbon derivativeslactamsmorpholinesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinespyrimidonesvinylogous amides |
|---|
| Substituents | etherlactampolyhalopyridinepyrimidonedialkyl etherpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridinedialkylarylamineaminopyridinevinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundoxazinaneoxacyclemorpholinepyridineorganic oxygen compoundpyrido[2,3-d]pyrimidinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|