| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:50 UTC |
|---|
| Update Date | 2025-03-25 00:59:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235231 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H32O3 |
|---|
| Molecular Mass | 344.2351 |
|---|
| SMILES | Cc1cc2c(cc1C(=O)CC(C)(C)C(=O)O)C(C)(C)CC(C)C2(C)C |
|---|
| InChI Key | FCXVSLFAPYVAFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | butyrophenones |
|---|
| Direct Parent | butyrophenones |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestetralins |
|---|
| Substituents | tetralincarbonyl groupcarboxylic acidaryl alkyl ketonearomatic homopolycyclic compoundcarboxylic acid derivativegamma-keto acidketonebutyrophenoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
