| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:51 UTC |
|---|
| Update Date | 2025-03-25 00:59:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235298 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O6S |
|---|
| Molecular Mass | 366.0886 |
|---|
| SMILES | Cc1ccc(Sc2cc(=O)[nH]c(=O)n2C2OC(CO)C(O)C2O)cc1 |
|---|
| InChI Key | QTEKVPALAIVWBK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdiarylthioethersheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonessecondary alcoholssulfenyl compoundstetrahydrofuransthiophenol ethersthiophenolstoluenesvinylogous amidesvinylogous thioesters |
|---|
| Substituents | monocyclic benzene moietylactamaromatic heteromonocyclic compoundmonosaccharidepyrimidoneorganosulfur compoundaryl thioetherpyrimidinesaccharideorganic oxidethiophenolthiophenol etherorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideprimary alcoholorganoheterocyclic compounddiarylthioetheralcoholvinylogous amidevinylogous thioestercarbonic acid derivativesulfenyl compoundazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundtolueneorganooxygen compound |
|---|
