| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:51 UTC |
|---|
| Update Date | 2025-03-25 00:59:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235302 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO5 |
|---|
| Molecular Mass | 281.1263 |
|---|
| SMILES | COC(=O)C(Cc1ccc(OC)c(OC)c1)NC(C)=O |
|---|
| InChI Key | XKIRPFISBIQOHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersalpha amino acid estersalpha amino acidsanisolescarbonyl compoundsdimethoxybenzenesfatty acid estershydrocarbon derivativesmethoxylated amphetaminesmethyl estersmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl etherdimethoxybenzeneorganic oxidemethyl estero-dimethoxybenzeneorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesacetamiden-acyl-alpha amino acid or derivativesalpha-amino acid estern-acyl-alpha-amino acidmethoxylated amphetaminecarboxamide groupmethoxybenzenearomatic homomonocyclic compoundsecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
