| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:56 UTC |
|---|
| Update Date | 2025-03-25 00:59:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235494 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O3 |
|---|
| Molecular Mass | 268.1099 |
|---|
| SMILES | COc1ccc(C=CC(=O)C=Cc2ccc(C)o2)cc1 |
|---|
| InChI Key | VBVQDEVPYHEIFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalkyl aryl ethersanisolesenonesfuransheteroaromatic compoundshydrocarbon derivativesketonesmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compounds |
|---|
| Substituents | furanphenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundheteroaromatic compoundalkyl aryl etheralpha,beta-unsaturated ketonemethoxybenzeneketoneoxacyclecinnamic acid or derivativesorganic oxideorganic oxygen compoundanisolehydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganoheterocyclic compoundorganooxygen compoundenone |
|---|
