| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:58 UTC |
|---|
| Update Date | 2025-03-25 00:59:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235576 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H24O11 |
|---|
| Molecular Mass | 476.1319 |
|---|
| SMILES | COc1ccc(C2COc3cc(OC)cc(OC4OC(C(=O)O)C(O)C(O)C4O)c3C2=O)cc1 |
|---|
| InChI Key | CLWGWNVBWSLVFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 4'-o-methylated isoflavonoids7-o-methylated isoflavonoidsacetalsalkyl aryl ethersanisolesaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acidschromonesglucuronic acid derivativeshydrocarbon derivativesisoflavanolsisoflavanonesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyrano-glucuronidemonosaccharidepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidsaccharideacetalchromoneoxaneorganoheterocyclic compound4p-methoxyisoflavonoidalcoholisoflavanbenzopyranmethoxybenzeneanisolehydrocarbon derivativephenoxy compoundisoflavonoid-5-o-glycoside7-methoxyisoflavonoid-skeletonaryl ketonecarbonyl groupetherglucuronic acid or derivativesisoflavanolalkyl aryl ethercarboxylic acid derivativeisoflavanoneorganic oxidearomatic heteropolycyclic compoundchromanepyran carboxylic acid or derivativesisoflavonoid o-glycosidehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholbenzenoidorganooxygen compound |
|---|