| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:14:59 UTC |
|---|
| Update Date | 2025-03-25 00:59:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235615 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13NO2 |
|---|
| Molecular Mass | 227.0946 |
|---|
| SMILES | OCCc1c[nH]c2cc3c(O)cccc3cc12 |
|---|
| InChI Key | KHCXCKXVOHBJEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalcohols and polyolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | alcoholazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidindole or derivatives1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-naphtholorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|