| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:01 UTC |
|---|
| Update Date | 2025-03-25 00:59:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235672 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24N2O2 |
|---|
| Molecular Mass | 324.1838 |
|---|
| SMILES | COc1ccc2[nH]cc(CCNCCC(O)c3ccccc3)c2c1 |
|---|
| InChI Key | UGDCISHJDAPEAF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic alcoholsazacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspyrrolessecondary alcohols |
|---|
| Substituents | aromatic alcoholphenol ethermonocyclic benzene moietyetherindolealkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholsecondary aliphatic amineazacycleheteroaromatic compoundsecondary amineorganic oxygen compoundanisolepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
