| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:02 UTC |
|---|
| Update Date | 2025-03-25 00:59:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO3 |
|---|
| Molecular Mass | 299.1521 |
|---|
| SMILES | COc1ccc2c(c1)C13CCN(C)C(C2)C1C(O)C=CC3=O |
|---|
| InChI Key | XORDNNAWAQGPJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsbenzazocinescyclohexenoneshydrocarbon derivativesketonesorganic oxidesorganopnictogen compoundsphenanthrenes and derivativespiperidinessecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | cyclohexenonetetralinphenol ethercarbonyl groupetheralkyl aryl etherketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholphenanthreneazacycletertiary aliphatic amineorganic oxygen compoundanisolebenzazocinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
